C12H14N2O — CID 68890298
[(2S)-2-(aminomethyl)-2,5-dihydropyrrol-1-yl]-phenylmethanone (PubChem CID 68890298) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is [(2S)-2-(aminomethyl)-2,5-dihydropyrrol-1-yl]-phenylmethanone.
| Compound Name | [(2S)-2-(aminomethyl)-2,5-dihydropyrrol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 68890298 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | [(2S)-2-(aminomethyl)-2,5-dihydropyrrol-1-yl]-phenylmethanone |
| SMILES | NC[C@@H]1C=CCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14N2O/c13-9-11-7-4-8-14(11)12(15)10-5-2-1-3-6-10/h1-7,11H,8-9,13H2/t11-/m0/s1 |
| InChIKey | ZTQUNGZCWUGUFK-NSHDSACASA-N |
| XLogP | 1.03 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|