C14H15Cl2NO2 — CID 131928651
(3,5-dichloro-4-methoxyphenyl)-(2-ethyl-2,5-dihydropyrrol-1-yl)methanone (PubChem CID 131928651) has the molecular formula C14H15Cl2NO2 and a molecular weight of 300.19 g/mol. Its IUPAC name is (3,5-dichloro-4-methoxyphenyl)-(2-ethyl-2,5-dihydropyrrol-1-yl)methanone.
| Compound Name | (3,5-dichloro-4-methoxyphenyl)-(2-ethyl-2,5-dihydropyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 131928651 |
| Molecular Formula | C14H15Cl2NO2 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (3,5-dichloro-4-methoxyphenyl)-(2-ethyl-2,5-dihydropyrrol-1-yl)methanone |
| SMILES | CCC1C=CCN1C(=O)c1cc(Cl)c(OC)c(Cl)c1 |
| InChI | InChI=1S/C14H15Cl2NO2/c1-3-10-5-4-6-17(10)14(18)9-7-11(15)13(19-2)12(16)8-9/h4-5,7-8,10H,3,6H2,1-2H3 |
| InChIKey | XFKOUHLXXKRADZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|