C25H27NO4 — CID 141007166
2-[2-[(2-methylpropan-2-yl)oxycarbonyl]-3,3-diphenylprop-2-enyl]-2,5-dihydropyrrole-1-carboxylic acid (PubChem CID 141007166) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxycarbonyl]-3,3-diphenylprop-2-enyl]-2,5-dihydropyrrole-1-carboxylic acid.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonyl]-3,3-diphenylprop-2-enyl]-2,5-dihydropyrrole-1-carboxylic acid |
|---|---|
| PubChem CID | 141007166 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonyl]-3,3-diphenylprop-2-enyl]-2,5-dihydropyrrole-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)C(CC1C=CCN1C(=O)O)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27NO4/c1-25(2,3)30-23(27)21(17-20-15-10-16-26(20)24(28)29)22(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-15,20H,16-17H2,1-3H3,(H,28,29) |
| InChIKey | MYEIZSPEIALQTE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|