C11H11NO2 — CID 125449500
4-(furan-2-yl)-1,6-dimethylpyridin-2-one (PubChem CID 125449500) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 4-(furan-2-yl)-1,6-dimethylpyridin-2-one.
| Compound Name | 4-(furan-2-yl)-1,6-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 125449500 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 4-(furan-2-yl)-1,6-dimethylpyridin-2-one |
| SMILES | Cc1cc(-c2ccco2)cc(=O)n1C |
| InChI | InChI=1S/C11H11NO2/c1-8-6-9(7-11(13)12(8)2)10-4-3-5-14-10/h3-7H,1-2H3 |
| InChIKey | FTPSFDCLGLDDNJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |