C11H10N4 — CID 125449573
4-methyl-3-(1H-pyrazol-4-ylamino)benzonitrile (PubChem CID 125449573) has the molecular formula C11H10N4 and a molecular weight of 198.23 g/mol. Its IUPAC name is 4-methyl-3-(1H-pyrazol-4-ylamino)benzonitrile.
| Compound Name | 4-methyl-3-(1H-pyrazol-4-ylamino)benzonitrile |
|---|---|
| PubChem CID | 125449573 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4-methyl-3-(1H-pyrazol-4-ylamino)benzonitrile |
| SMILES | Cc1ccc(C#N)cc1Nc1cn[nH]c1 |
| InChI | InChI=1S/C11H10N4/c1-8-2-3-9(5-12)4-11(8)15-10-6-13-14-7-10/h2-4,6-7,15H,1H3,(H,13,14) |
| InChIKey | HPZLLMPUSCTFAS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |