About 4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride
4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride (PubChem CID 125453006) has the molecular formula C8H9ClN2O5S2
and a molecular weight of 312.76 g/mol. Its IUPAC name is 4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride |
| PubChem CID | 125453006 |
| Molecular Formula | C8H9ClN2O5S2 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride |
| SMILES | CS(C)(=O)=Nc1ccc(S(=O)(=O)Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9ClN2O5S2/c1-17(2,14)10-7-4-3-6(18(9,15)16)5-8(7)11(12)13/h3-5H,1-2H3 |
| InChIKey | JMOMFAQZZFTKGW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 106.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride?
The IUPAC name of 4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride (CID 125453006) is 4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride.
What is the SMILES notation for 4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride?
The canonical SMILES for 4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride is CS(C)(=O)=Nc1ccc(S(=O)(=O)Cl)cc1[N+](=O)[O-].
What is the InChIKey of 4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride?
The InChIKey is JMOMFAQZZFTKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2O5S2/c1-17(2,14)10-7-4-3-6(18(9,15)16)5-8(7)11(12)13/h3-5H,1-2H3.
What are the key properties of 4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride?
4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride has a molecular weight of 312.76 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-3-nitrobenzenesulfonyl chloride is sourced from PubChem (CID 125453006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).