About imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane
imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane (PubChem CID 125456475) has the molecular formula C6H15NOS
and a molecular weight of 149.26 g/mol. Its IUPAC name is imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane |
| PubChem CID | 125456475 |
| Molecular Formula | C6H15NOS |
| Molecular Weight | 149.26 g/mol |
| Exact Mass | 149.09 |
| IUPAC Name | imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane |
| SMILES | [H]N=[S@@](C)(=O)[C@H](C)C(C)C |
| InChI | InChI=1S/C6H15NOS/c1-5(2)6(3)9(4,7)8/h5-7H,1-4H3/t6-,9+/m1/s1 |
| InChIKey | NHMSSGHPDXIYSF-MUWHJKNJSA-N |
| XLogP | 1.71 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane?
The IUPAC name of imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane (CID 125456475) is imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane.
What is the SMILES notation for imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane?
The canonical SMILES for imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane is [H]N=[S@@](C)(=O)[C@H](C)C(C)C.
What is the InChIKey of imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane?
The InChIKey is NHMSSGHPDXIYSF-MUWHJKNJSA-N. The full InChI is InChI=1S/C6H15NOS/c1-5(2)6(3)9(4,7)8/h5-7H,1-4H3/t6-,9+/m1/s1.
What are the key properties of imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane?
imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane has a molecular weight of 149.26 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for imino-methyl-[(2R)-3-methylbutan-2-yl]-oxo-λ6-sulfane is sourced from PubChem (CID 125456475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).