C9H17BrO — CID 125456560
(2S,4R)-2-(bromomethyl)-4-tert-butyloxolane (PubChem CID 125456560) has the molecular formula C9H17BrO and a molecular weight of 221.14 g/mol. Its IUPAC name is (2S,4R)-2-(bromomethyl)-4-tert-butyloxolane.
| Compound Name | (2S,4R)-2-(bromomethyl)-4-tert-butyloxolane |
|---|---|
| PubChem CID | 125456560 |
| Molecular Formula | C9H17BrO |
| Molecular Weight | 221.14 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (2S,4R)-2-(bromomethyl)-4-tert-butyloxolane |
| SMILES | CC(C)(C)[C@@H]1CO[C@H](CBr)C1 |
| InChI | InChI=1S/C9H17BrO/c1-9(2,3)7-4-8(5-10)11-6-7/h7-8H,4-6H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | OGJVXDKKBLBMRF-YUMQZZPRSA-N |
| XLogP | 2.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.14 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|