C11H13BrN2O — CID 125457630
(4S,5R)-5-(2-amino-5-bromophenyl)-4-methylpyrrolidin-2-one (PubChem CID 125457630) has the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. Its IUPAC name is (4S,5R)-5-(2-amino-5-bromophenyl)-4-methylpyrrolidin-2-one.
| Compound Name | (4S,5R)-5-(2-amino-5-bromophenyl)-4-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 125457630 |
| Molecular Formula | C11H13BrN2O |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | (4S,5R)-5-(2-amino-5-bromophenyl)-4-methylpyrrolidin-2-one |
| SMILES | C[C@H]1CC(=O)N[C@H]1c1cc(Br)ccc1N |
| InChI | InChI=1S/C11H13BrN2O/c1-6-4-10(15)14-11(6)8-5-7(12)2-3-9(8)13/h2-3,5-6,11H,4,13H2,1H3,(H,14,15)/t6-,11+/m0/s1 |
| InChIKey | RIEPPUOOBYXWQV-UPONEAKYSA-N |
| XLogP | 2.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|