C8H12F3NO2 — CID 125458470
2-[(3S,6S)-6-(trifluoromethyl)piperidin-3-yl]acetic acid (PubChem CID 125458470) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is 2-[(3S,6S)-6-(trifluoromethyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3S,6S)-6-(trifluoromethyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 125458470 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-[(3S,6S)-6-(trifluoromethyl)piperidin-3-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CC[C@@H](C(F)(F)F)NC1 |
| InChI | InChI=1S/C8H12F3NO2/c9-8(10,11)6-2-1-5(4-12-6)3-7(13)14/h5-6,12H,1-4H2,(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | YKVLYHGGHUQTRH-WDSKDSINSA-N |
| XLogP | 1.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |