C8H12F3NO2 — CID 125424409
3-[(2R,5R)-5-(trifluoromethyl)pyrrolidin-2-yl]propanoic acid (PubChem CID 125424409) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is 3-[(2R,5R)-5-(trifluoromethyl)pyrrolidin-2-yl]propanoic acid.
| Compound Name | 3-[(2R,5R)-5-(trifluoromethyl)pyrrolidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 125424409 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3-[(2R,5R)-5-(trifluoromethyl)pyrrolidin-2-yl]propanoic acid |
| SMILES | O=C(O)CC[C@H]1CC[C@H](C(F)(F)F)N1 |
| InChI | InChI=1S/C8H12F3NO2/c9-8(10,11)6-3-1-5(12-6)2-4-7(13)14/h5-6,12H,1-4H2,(H,13,14)/t5-,6-/m1/s1 |
| InChIKey | PLWZSCLEJDASFO-PHDIDXHHSA-N |
| XLogP | 1.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |