About 1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea
1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea (PubChem CID 125458925) has the molecular formula C18H26N4O
and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea.
Molecular Properties
| Compound Name | 1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea |
| PubChem CID | 125458925 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea |
| SMILES | Cc1c(CN(C)C(=O)NCC[C@@H](C)c2ccccc2)cnn1C |
| InChI | InChI=1S/C18H26N4O/c1-14(16-8-6-5-7-9-16)10-11-19-18(23)21(3)13-17-12-20-22(4)15(17)2/h5-9,12,14H,10-11,13H2,1-4H3,(H,19,23)/t14-/m1/s1 |
| InChIKey | GRHXAKUTYQWPDT-CQSZACIVSA-N |
| XLogP | 3.06 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea?
The IUPAC name of 1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea (CID 125458925) is 1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea.
What is the SMILES notation for 1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea?
The canonical SMILES for 1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea is Cc1c(CN(C)C(=O)NCC[C@@H](C)c2ccccc2)cnn1C.
What is the InChIKey of 1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea?
The InChIKey is GRHXAKUTYQWPDT-CQSZACIVSA-N. The full InChI is InChI=1S/C18H26N4O/c1-14(16-8-6-5-7-9-16)10-11-19-18(23)21(3)13-17-12-20-22(4)15(17)2/h5-9,12,14H,10-11,13H2,1-4H3,(H,19,23)/t14-/m1/s1.
What are the key properties of 1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea?
1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea has a molecular weight of 314.43 g/mol, XLogP of 3.06, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,5-dimethylpyrazol-4-yl)methyl]-1-methyl-3-[(3R)-3-phenylbutyl]urea is sourced from PubChem (CID 125458925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).