About 2-diazobutane
2-diazobutane (PubChem CID 12546270) has the molecular formula C4H8N2
and a molecular weight of 84.12 g/mol. Its IUPAC name is 2-diazobutane.
Molecular Properties
| Compound Name | 2-diazobutane |
| PubChem CID | 12546270 |
| Molecular Formula | C4H8N2 |
| Molecular Weight | 84.12 g/mol |
| Exact Mass | 84.07 |
| IUPAC Name | 2-diazobutane |
| SMILES | CCC(C)=[N+]=[N-] |
| InChI | InChI=1S/C4H8N2/c1-3-4(2)6-5/h3H2,1-2H3 |
| InChIKey | WDWZAYNDFGKPHQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.12 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-diazobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazobutane?
The IUPAC name of 2-diazobutane (CID 12546270) is 2-diazobutane.
What is the SMILES notation for 2-diazobutane?
The canonical SMILES for 2-diazobutane is CCC(C)=[N+]=[N-].
What is the InChIKey of 2-diazobutane?
The InChIKey is WDWZAYNDFGKPHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2/c1-3-4(2)6-5/h3H2,1-2H3.
What are the key properties of 2-diazobutane?
2-diazobutane has a molecular weight of 84.12 g/mol, XLogP of 1.09, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazobutane is sourced from PubChem (CID 12546270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).