C19H21BrO — CID 125465285
1-bromo-4-[(Z,3S)-4-(4-methoxyphenyl)hex-4-en-3-yl]benzene (PubChem CID 125465285) has the molecular formula C19H21BrO and a molecular weight of 345.28 g/mol. Its IUPAC name is 1-bromo-4-[(Z,3S)-4-(4-methoxyphenyl)hex-4-en-3-yl]benzene.
| Compound Name | 1-bromo-4-[(Z,3S)-4-(4-methoxyphenyl)hex-4-en-3-yl]benzene |
|---|---|
| PubChem CID | 125465285 |
| Molecular Formula | C19H21BrO |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-bromo-4-[(Z,3S)-4-(4-methoxyphenyl)hex-4-en-3-yl]benzene |
| SMILES | C/C=C(\c1ccc(OC)cc1)[C@@H](CC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H21BrO/c1-4-18(14-6-10-16(20)11-7-14)19(5-2)15-8-12-17(21-3)13-9-15/h5-13,18H,4H2,1-3H3/b19-5+/t18-/m0/s1 |
| InChIKey | JSKVRBYFKHYHFC-URJJWMHMSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |