C29H40O4 — CID 18955970
(Z)-12,13-bis(4-methoxyphenyl)pentadec-11-enoic acid (PubChem CID 18955970) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is (Z)-12,13-bis(4-methoxyphenyl)pentadec-11-enoic acid.
| Compound Name | (Z)-12,13-bis(4-methoxyphenyl)pentadec-11-enoic acid |
|---|---|
| PubChem CID | 18955970 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | (Z)-12,13-bis(4-methoxyphenyl)pentadec-11-enoic acid |
| SMILES | CCC(/C(=C/CCCCCCCCCC(=O)O)c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H40O4/c1-4-27(23-15-19-25(32-2)20-16-23)28(24-17-21-26(33-3)22-18-24)13-11-9-7-5-6-8-10-12-14-29(30)31/h13,15-22,27H,4-12,14H2,1-3H3,(H,30,31)/b28-13+ |
| InChIKey | CEAIXXNBBCBSIW-XODNFHPESA-N |
| XLogP | 7.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|