C14H21BrO — CID 125465436
1-(3-bromopropoxy)-2,3,4,5,6-pentamethylbenzene (PubChem CID 125465436) has the molecular formula C14H21BrO and a molecular weight of 285.23 g/mol. Its IUPAC name is 1-(3-bromopropoxy)-2,3,4,5,6-pentamethylbenzene.
| Compound Name | 1-(3-bromopropoxy)-2,3,4,5,6-pentamethylbenzene |
|---|---|
| PubChem CID | 125465436 |
| Molecular Formula | C14H21BrO |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-(3-bromopropoxy)-2,3,4,5,6-pentamethylbenzene |
| SMILES | Cc1c(C)c(C)c(OCCCBr)c(C)c1C |
| InChI | InChI=1S/C14H21BrO/c1-9-10(2)12(4)14(13(5)11(9)3)16-8-6-7-15/h6-8H2,1-5H3 |
| InChIKey | ZHWYBXNZYFZPAK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|