C19H20FN3 — CID 125466541
(1S)-1-[2-[3-[2-(4-fluorophenyl)ethyl]imidazol-4-yl]phenyl]ethanamine (PubChem CID 125466541) has the molecular formula C19H20FN3 and a molecular weight of 309.39 g/mol. Its IUPAC name is (1S)-1-[2-[3-[2-(4-fluorophenyl)ethyl]imidazol-4-yl]phenyl]ethanamine.
| Compound Name | (1S)-1-[2-[3-[2-(4-fluorophenyl)ethyl]imidazol-4-yl]phenyl]ethanamine |
|---|---|
| PubChem CID | 125466541 |
| Molecular Formula | C19H20FN3 |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (1S)-1-[2-[3-[2-(4-fluorophenyl)ethyl]imidazol-4-yl]phenyl]ethanamine |
| SMILES | C[C@H](N)c1ccccc1-c1cncn1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN3/c1-14(21)17-4-2-3-5-18(17)19-12-22-13-23(19)11-10-15-6-8-16(20)9-7-15/h2-9,12-14H,10-11,21H2,1H3/t14-/m0/s1 |
| InChIKey | NSSOKDHYSWMURR-AWEZNQCLSA-N |
| XLogP | 3.95 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |