C11H14FN5 — CID 103085331
1-[1-[2-(4-fluorophenyl)ethyl]tetrazol-5-yl]ethanamine (PubChem CID 103085331) has the molecular formula C11H14FN5 and a molecular weight of 235.27 g/mol. Its IUPAC name is 1-[1-[2-(4-fluorophenyl)ethyl]tetrazol-5-yl]ethanamine.
| Compound Name | 1-[1-[2-(4-fluorophenyl)ethyl]tetrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103085331 |
| Molecular Formula | C11H14FN5 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1-[1-[2-(4-fluorophenyl)ethyl]tetrazol-5-yl]ethanamine |
| SMILES | CC(N)c1nnnn1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FN5/c1-8(13)11-14-15-16-17(11)7-6-9-2-4-10(12)5-3-9/h2-5,8H,6-7,13H2,1H3 |
| InChIKey | BWBRACGEGHCDQK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |