C9H13ClNO3P — CID 125471815
(6-chloro-3,4-diethyl-2-pyridinyl)phosphonic acid (PubChem CID 125471815) has the molecular formula C9H13ClNO3P and a molecular weight of 249.63 g/mol. Its IUPAC name is (6-chloro-3,4-diethyl-2-pyridinyl)phosphonic acid.
| Compound Name | (6-chloro-3,4-diethyl-2-pyridinyl)phosphonic acid |
|---|---|
| PubChem CID | 125471815 |
| Molecular Formula | C9H13ClNO3P |
| Molecular Weight | 249.63 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | (6-chloro-3,4-diethyl-2-pyridinyl)phosphonic acid |
| SMILES | CCc1cc(Cl)nc(P(=O)(O)O)c1CC |
| InChI | InChI=1S/C9H13ClNO3P/c1-3-6-5-8(10)11-9(7(6)4-2)15(12,13)14/h5H,3-4H2,1-2H3,(H2,12,13,14) |
| InChIKey | ZTRVGSMVYDCPDO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.63 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|