About N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide
N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide (PubChem CID 125472970) has the molecular formula C15H22ClNO3
and a molecular weight of 299.80 g/mol. Its IUPAC name is N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide.
Molecular Properties
| Compound Name | N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide |
| PubChem CID | 125472970 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide |
| SMILES | CC[C@H](NC=O)[C@H](C)c1ccc(Cl)c(OCCOC)c1 |
| InChI | InChI=1S/C15H22ClNO3/c1-4-14(17-10-18)11(2)12-5-6-13(16)15(9-12)20-8-7-19-3/h5-6,9-11,14H,4,7-8H2,1-3H3,(H,17,18)/t11-,14+/m1/s1 |
| InChIKey | WZVLPRIYNLRZSE-RISCZKNCSA-N |
| XLogP | 2.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide?
The IUPAC name of N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide (CID 125472970) is N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide.
What is the SMILES notation for N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide?
The canonical SMILES for N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide is CC[C@H](NC=O)[C@H](C)c1ccc(Cl)c(OCCOC)c1.
What is the InChIKey of N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide?
The InChIKey is WZVLPRIYNLRZSE-RISCZKNCSA-N. The full InChI is InChI=1S/C15H22ClNO3/c1-4-14(17-10-18)11(2)12-5-6-13(16)15(9-12)20-8-7-19-3/h5-6,9-11,14H,4,7-8H2,1-3H3,(H,17,18)/t11-,14+/m1/s1.
What are the key properties of N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide?
N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide has a molecular weight of 299.80 g/mol, XLogP of 2.99, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,3S)-2-[4-chloro-3-(2-methoxyethoxy)phenyl]pentan-3-yl]formamide is sourced from PubChem (CID 125472970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).