C12H11ClO2 — CID 125475083
[(1E,3Z)-3-chloro-4-phenylbuta-1,3-dienyl] acetate (PubChem CID 125475083) has the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. Its IUPAC name is [(1E,3Z)-3-chloro-4-phenylbuta-1,3-dienyl] acetate.
| Compound Name | [(1E,3Z)-3-chloro-4-phenylbuta-1,3-dienyl] acetate |
|---|---|
| PubChem CID | 125475083 |
| Molecular Formula | C12H11ClO2 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | [(1E,3Z)-3-chloro-4-phenylbuta-1,3-dienyl] acetate |
| SMILES | CC(=O)O/C=C/C(Cl)=C/c1ccccc1 |
| InChI | InChI=1S/C12H11ClO2/c1-10(14)15-8-7-12(13)9-11-5-3-2-4-6-11/h2-9H,1H3/b8-7+,12-9- |
| InChIKey | YRSYCCFWVXGKCY-GHYOLMRSSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|