C12H13ClO2 — CID 125475706
(3R,4S)-4-(4-chlorophenyl)-3-ethyloxolan-2-one (PubChem CID 125475706) has the molecular formula C12H13ClO2 and a molecular weight of 224.69 g/mol. Its IUPAC name is (3R,4S)-4-(4-chlorophenyl)-3-ethyloxolan-2-one.
| Compound Name | (3R,4S)-4-(4-chlorophenyl)-3-ethyloxolan-2-one |
|---|---|
| PubChem CID | 125475706 |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | (3R,4S)-4-(4-chlorophenyl)-3-ethyloxolan-2-one |
| SMILES | CC[C@H]1C(=O)OC[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClO2/c1-2-10-11(7-15-12(10)14)8-3-5-9(13)6-4-8/h3-6,10-11H,2,7H2,1H3/t10-,11-/m1/s1 |
| InChIKey | AOJBUJVVEJKLPE-GHMZBOCLSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |