C15H17ClO3 — CID 2893845
6-(4-chlorophenyl)-5-ethyl-3,3-dimethyloxane-2,4-dione (PubChem CID 2893845) has the molecular formula C15H17ClO3 and a molecular weight of 280.75 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-5-ethyl-3,3-dimethyloxane-2,4-dione.
| Compound Name | 6-(4-chlorophenyl)-5-ethyl-3,3-dimethyloxane-2,4-dione |
|---|---|
| PubChem CID | 2893845 |
| Molecular Formula | C15H17ClO3 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 6-(4-chlorophenyl)-5-ethyl-3,3-dimethyloxane-2,4-dione |
| SMILES | CCC1C(=O)C(C)(C)C(=O)OC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClO3/c1-4-11-12(9-5-7-10(16)8-6-9)19-14(18)15(2,3)13(11)17/h5-8,11-12H,4H2,1-3H3 |
| InChIKey | BACBEVFAACTKOF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|