C15H17BrO3 — CID 703877
(5R,6S)-6-(3-bromophenyl)-5-ethyl-3,3-dimethyloxane-2,4-dione (PubChem CID 703877) has the molecular formula C15H17BrO3 and a molecular weight of 325.20 g/mol. Its IUPAC name is (5R,6S)-6-(3-bromophenyl)-5-ethyl-3,3-dimethyloxane-2,4-dione.
| Compound Name | (5R,6S)-6-(3-bromophenyl)-5-ethyl-3,3-dimethyloxane-2,4-dione |
|---|---|
| PubChem CID | 703877 |
| Molecular Formula | C15H17BrO3 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (5R,6S)-6-(3-bromophenyl)-5-ethyl-3,3-dimethyloxane-2,4-dione |
| SMILES | CC[C@H]1C(=O)C(C)(C)C(=O)O[C@@H]1c1cccc(Br)c1 |
| InChI | InChI=1S/C15H17BrO3/c1-4-11-12(9-6-5-7-10(16)8-9)19-14(18)15(2,3)13(11)17/h5-8,11-12H,4H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | WQODTAZBDZLKLW-VXGBXAGGSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|