C10H10INO3 — CID 125476357
(E,1S)-4-iodo-1-(4-nitrophenyl)but-3-en-1-ol (PubChem CID 125476357) has the molecular formula C10H10INO3 and a molecular weight of 319.10 g/mol. Its IUPAC name is (E,1S)-4-iodo-1-(4-nitrophenyl)but-3-en-1-ol.
| Compound Name | (E,1S)-4-iodo-1-(4-nitrophenyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 125476357 |
| Molecular Formula | C10H10INO3 |
| Molecular Weight | 319.10 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | (E,1S)-4-iodo-1-(4-nitrophenyl)but-3-en-1-ol |
| SMILES | O=[N+]([O-])c1ccc([C@@H](O)C/C=C/I)cc1 |
| InChI | InChI=1S/C10H10INO3/c11-7-1-2-10(13)8-3-5-9(6-4-8)12(14)15/h1,3-7,10,13H,2H2/b7-1+/t10-/m0/s1 |
| InChIKey | RGTJJCOGYFFOSU-RKLHAHJXSA-N |
| XLogP | 2.97 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.10 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|