C18H19NO6 — CID 56839902
2-[(E)-4-hydroxy-4-(4-nitrophenyl)but-1-enyl]-6-methoxy-3,5-dimethylpyran-4-one (PubChem CID 56839902) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is 2-[(E)-4-hydroxy-4-(4-nitrophenyl)but-1-enyl]-6-methoxy-3,5-dimethylpyran-4-one.
| Compound Name | 2-[(E)-4-hydroxy-4-(4-nitrophenyl)but-1-enyl]-6-methoxy-3,5-dimethylpyran-4-one |
|---|---|
| PubChem CID | 56839902 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-[(E)-4-hydroxy-4-(4-nitrophenyl)but-1-enyl]-6-methoxy-3,5-dimethylpyran-4-one |
| SMILES | COc1oc(/C=C/CC(O)c2ccc([N+](=O)[O-])cc2)c(C)c(=O)c1C |
| InChI | InChI=1S/C18H19NO6/c1-11-16(25-18(24-3)12(2)17(11)21)6-4-5-15(20)13-7-9-14(10-8-13)19(22)23/h4,6-10,15,20H,5H2,1-3H3/b6-4+ |
| InChIKey | MYXJGFDMNXVERV-GQCTYLIASA-N |
| XLogP | 3.31 |
| TPSA | 102.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|