C21H23NO6 — CID 46898046
6-[(1R,3E,5E)-1-hydroxy-3-methyl-6-(4-nitrophenyl)hexa-3,5-dienyl]-4-methoxy-3,5-dimethylpyran-2-one (PubChem CID 46898046) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is 6-[(1R,3E,5E)-1-hydroxy-3-methyl-6-(4-nitrophenyl)hexa-3,5-dienyl]-4-methoxy-3,5-dimethylpyran-2-one.
| Compound Name | 6-[(1R,3E,5E)-1-hydroxy-3-methyl-6-(4-nitrophenyl)hexa-3,5-dienyl]-4-methoxy-3,5-dimethylpyran-2-one |
|---|---|
| PubChem CID | 46898046 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 6-[(1R,3E,5E)-1-hydroxy-3-methyl-6-(4-nitrophenyl)hexa-3,5-dienyl]-4-methoxy-3,5-dimethylpyran-2-one |
| SMILES | COc1c(C)c([C@H](O)C/C(C)=C/C=C/c2ccc([N+](=O)[O-])cc2)oc(=O)c1C |
| InChI | InChI=1S/C21H23NO6/c1-13(6-5-7-16-8-10-17(11-9-16)22(25)26)12-18(23)20-14(2)19(27-4)15(3)21(24)28-20/h5-11,18,23H,12H2,1-4H3/b7-5+,13-6+/t18-/m1/s1 |
| InChIKey | XXCKGCTXHBAKLR-RLZVURMLSA-N |
| XLogP | 4.26 |
| TPSA | 102.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|