C7H8F3IO2 — CID 125477527
(Z)-4-ethoxy-1,1,1-trifluoro-3-(iodomethyl)but-3-en-2-one (PubChem CID 125477527) has the molecular formula C7H8F3IO2 and a molecular weight of 308.04 g/mol. Its IUPAC name is (Z)-4-ethoxy-1,1,1-trifluoro-3-(iodomethyl)but-3-en-2-one.
| Compound Name | (Z)-4-ethoxy-1,1,1-trifluoro-3-(iodomethyl)but-3-en-2-one |
|---|---|
| PubChem CID | 125477527 |
| Molecular Formula | C7H8F3IO2 |
| Molecular Weight | 308.04 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | (Z)-4-ethoxy-1,1,1-trifluoro-3-(iodomethyl)but-3-en-2-one |
| SMILES | CCO/C=C(\CI)C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H8F3IO2/c1-2-13-4-5(3-11)6(12)7(8,9)10/h4H,2-3H2,1H3/b5-4+ |
| InChIKey | BFJIIGJUYTYUDY-SNAWJCMRSA-N |
| XLogP | 2.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.04 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|