C13H19N3O — CID 125478912
[(3S)-2-butyl-3-phenyl-3H-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 125478912) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is [(3S)-2-butyl-3-phenyl-3H-1,2,4-oxadiazol-5-yl]methanamine.
| Compound Name | [(3S)-2-butyl-3-phenyl-3H-1,2,4-oxadiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 125478912 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | [(3S)-2-butyl-3-phenyl-3H-1,2,4-oxadiazol-5-yl]methanamine |
| SMILES | CCCCN1OC(CN)=N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H19N3O/c1-2-3-9-16-13(15-12(10-14)17-16)11-7-5-4-6-8-11/h4-8,13H,2-3,9-10,14H2,1H3/t13-/m0/s1 |
| InChIKey | OKPSJLQFICJBLI-ZDUSSCGKSA-N |
| XLogP | 2.09 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |