C13H19NO — CID 17386684
3-butyl-2-phenyl-1,3-oxazolidine (PubChem CID 17386684) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-butyl-2-phenyl-1,3-oxazolidine.
| Compound Name | 3-butyl-2-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 17386684 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 3-butyl-2-phenyl-1,3-oxazolidine |
| SMILES | CCCCN1CCOC1c1ccccc1 |
| InChI | InChI=1S/C13H19NO/c1-2-3-9-14-10-11-15-13(14)12-7-5-4-6-8-12/h4-8,13H,2-3,9-11H2,1H3 |
| InChIKey | YWYNAMMQZQZLDY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |