C19H27NO — CID 11899512
(2R)-2-phenyl-3-[[(1R,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]-1,3-oxazolidine (PubChem CID 11899512) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (2R)-2-phenyl-3-[[(1R,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]-1,3-oxazolidine.
| Compound Name | (2R)-2-phenyl-3-[[(1R,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 11899512 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (2R)-2-phenyl-3-[[(1R,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]-1,3-oxazolidine |
| SMILES | CC1=C[C@@H](C)[C@H](CN2CCO[C@@H]2c2ccccc2)[C@H](C)C1 |
| InChI | InChI=1S/C19H27NO/c1-14-11-15(2)18(16(3)12-14)13-20-9-10-21-19(20)17-7-5-4-6-8-17/h4-8,11,15-16,18-19H,9-10,12-13H2,1-3H3/t15-,16-,18+,19-/m1/s1 |
| InChIKey | DXVJYGDLPSMKDE-ZAWLATJESA-N |
| XLogP | 4.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|