C12H17NO — CID 82111871
2-(4-ethylphenyl)-3-methyl-1,3-oxazolidine (PubChem CID 82111871) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-3-methyl-1,3-oxazolidine.
| Compound Name | 2-(4-ethylphenyl)-3-methyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 82111871 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-(4-ethylphenyl)-3-methyl-1,3-oxazolidine |
| SMILES | CCc1ccc(C2OCCN2C)cc1 |
| InChI | InChI=1S/C12H17NO/c1-3-10-4-6-11(7-5-10)12-13(2)8-9-14-12/h4-7,12H,3,8-9H2,1-2H3 |
| InChIKey | LWJKWXCEECZXOU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |