C13H16N2O5S — CID 125479385
[(2S)-2-hydroxy-3-[4-(1H-imidazol-2-yl)phenoxy]propyl] methanesulfonate (PubChem CID 125479385) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[4-(1H-imidazol-2-yl)phenoxy]propyl] methanesulfonate.
| Compound Name | [(2S)-2-hydroxy-3-[4-(1H-imidazol-2-yl)phenoxy]propyl] methanesulfonate |
|---|---|
| PubChem CID | 125479385 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [(2S)-2-hydroxy-3-[4-(1H-imidazol-2-yl)phenoxy]propyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H](O)COc1ccc(-c2ncc[nH]2)cc1 |
| InChI | InChI=1S/C13H16N2O5S/c1-21(17,18)20-9-11(16)8-19-12-4-2-10(3-5-12)13-14-6-7-15-13/h2-7,11,16H,8-9H2,1H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | DXNAYJWBOUNOHC-NSHDSACASA-N |
| XLogP | 0.79 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|