C19H26ClN — CID 125480988
(4aS,6R,6aS,10aS)-6-chloro-6-phenyl-1,2,3,4,4a,5,6a,7,8,9,10,10a-dodecahydrobenzo[c]quinolizine (PubChem CID 125480988) has the molecular formula C19H26ClN and a molecular weight of 303.88 g/mol. Its IUPAC name is (4aS,6R,6aS,10aS)-6-chloro-6-phenyl-1,2,3,4,4a,5,6a,7,8,9,10,10a-dodecahydrobenzo[c]quinolizine.
| Compound Name | (4aS,6R,6aS,10aS)-6-chloro-6-phenyl-1,2,3,4,4a,5,6a,7,8,9,10,10a-dodecahydrobenzo[c]quinolizine |
|---|---|
| PubChem CID | 125480988 |
| Molecular Formula | C19H26ClN |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (4aS,6R,6aS,10aS)-6-chloro-6-phenyl-1,2,3,4,4a,5,6a,7,8,9,10,10a-dodecahydrobenzo[c]quinolizine |
| SMILES | Cl[C@]1(c2ccccc2)C[C@@H]2CCCCN2[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C19H26ClN/c20-19(15-8-2-1-3-9-15)14-16-10-6-7-13-21(16)18-12-5-4-11-17(18)19/h1-3,8-9,16-18H,4-7,10-14H2/t16-,17-,18-,19-/m0/s1 |
| InChIKey | LYTMAJLUFSVFMR-VJANTYMQSA-N |
| XLogP | 4.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|