C20H20N2O3 — CID 125483095
benzyl (2S,5S)-2-(4-cyanophenyl)-5-hydroxypiperidine-1-carboxylate (PubChem CID 125483095) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is benzyl (2S,5S)-2-(4-cyanophenyl)-5-hydroxypiperidine-1-carboxylate.
| Compound Name | benzyl (2S,5S)-2-(4-cyanophenyl)-5-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 125483095 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | benzyl (2S,5S)-2-(4-cyanophenyl)-5-hydroxypiperidine-1-carboxylate |
| SMILES | N#Cc1ccc([C@@H]2CC[C@H](O)CN2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H20N2O3/c21-12-15-6-8-17(9-7-15)19-11-10-18(23)13-22(19)20(24)25-14-16-4-2-1-3-5-16/h1-9,18-19,23H,10-11,13-14H2/t18-,19-/m0/s1 |
| InChIKey | YPTKBZMSEJQJKU-OALUTQOASA-N |
| XLogP | 3.39 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |