C21H20N2O4S — CID 176894561
benzyl 2-(4-cyanophenyl)-4-(sulfonylmethyl)piperidine-1-carboxylate (PubChem CID 176894561) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is benzyl 2-(4-cyanophenyl)-4-(sulfonylmethyl)piperidine-1-carboxylate.
| Compound Name | benzyl 2-(4-cyanophenyl)-4-(sulfonylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 176894561 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | benzyl 2-(4-cyanophenyl)-4-(sulfonylmethyl)piperidine-1-carboxylate |
| SMILES | N#Cc1ccc(C2CC(C=S(=O)=O)CCN2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O4S/c22-13-16-6-8-19(9-7-16)20-12-18(15-28(25)26)10-11-23(20)21(24)27-14-17-4-2-1-3-5-17/h1-9,15,18,20H,10-12,14H2 |
| InChIKey | ZOQPWPANLBARLM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|