C8H11F3O4S — CID 125486002
[(1S)-2-ethoxy-1-ethylsulfanyl-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 125486002) has the molecular formula C8H11F3O4S and a molecular weight of 260.23 g/mol. Its IUPAC name is [(1S)-2-ethoxy-1-ethylsulfanyl-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S)-2-ethoxy-1-ethylsulfanyl-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 125486002 |
| Molecular Formula | C8H11F3O4S |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | [(1S)-2-ethoxy-1-ethylsulfanyl-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | CCOC(=O)[C@@H](OC(=O)C(F)(F)F)SCC |
| InChI | InChI=1S/C8H11F3O4S/c1-3-14-5(12)6(16-4-2)15-7(13)8(9,10)11/h6H,3-4H2,1-2H3/t6-/m0/s1 |
| InChIKey | WWMNNQFNJKUIMO-LURJTMIESA-N |
| XLogP | 1.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|