C10H14O7S — CID 559653
1,4,7,10-tetraoxa-13-thiacyclopentadecane-3,11,14-trione (PubChem CID 559653) has the molecular formula C10H14O7S and a molecular weight of 278.28 g/mol. Its IUPAC name is 1,4,7,10-tetraoxa-13-thiacyclopentadecane-3,11,14-trione.
| Compound Name | 1,4,7,10-tetraoxa-13-thiacyclopentadecane-3,11,14-trione |
|---|---|
| PubChem CID | 559653 |
| Molecular Formula | C10H14O7S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 1,4,7,10-tetraoxa-13-thiacyclopentadecane-3,11,14-trione |
| SMILES | O=C1COCC(=O)SCC(=O)OCCOCCO1 |
| InChI | InChI=1S/C10H14O7S/c11-8-5-15-6-10(13)18-7-9(12)17-4-2-14-1-3-16-8/h1-7H2 |
| InChIKey | JSWWCBIROZXPBN-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|