C15H26O2Si — CID 125486851
(E,4S)-3,4-dimethyl-4-triethylsilyloxyhept-2-en-6-ynal (PubChem CID 125486851) has the molecular formula C15H26O2Si and a molecular weight of 266.46 g/mol. Its IUPAC name is (E,4S)-3,4-dimethyl-4-triethylsilyloxyhept-2-en-6-ynal.
| Compound Name | (E,4S)-3,4-dimethyl-4-triethylsilyloxyhept-2-en-6-ynal |
|---|---|
| PubChem CID | 125486851 |
| Molecular Formula | C15H26O2Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (E,4S)-3,4-dimethyl-4-triethylsilyloxyhept-2-en-6-ynal |
| SMILES | C#CC[C@](C)(O[Si](CC)(CC)CC)/C(C)=C/C=O |
| InChI | InChI=1S/C15H26O2Si/c1-7-12-15(6,14(5)11-13-16)17-18(8-2,9-3)10-4/h1,11,13H,8-10,12H2,2-6H3/b14-11+/t15-/m0/s1 |
| InChIKey | RSDOLFWVVYUKNY-GOFCXVBSSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|