C19H40O2Si2 — CID 10570287
tert-butyl-dimethyl-[(3R)-3-methyl-3-triethylsilyloxyhex-5-ynoxy]silane (PubChem CID 10570287) has the molecular formula C19H40O2Si2 and a molecular weight of 356.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3R)-3-methyl-3-triethylsilyloxyhex-5-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(3R)-3-methyl-3-triethylsilyloxyhex-5-ynoxy]silane |
|---|---|
| PubChem CID | 10570287 |
| Molecular Formula | C19H40O2Si2 |
| Molecular Weight | 356.70 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | tert-butyl-dimethyl-[(3R)-3-methyl-3-triethylsilyloxyhex-5-ynoxy]silane |
| SMILES | C#CC[C@](C)(CCO[Si](C)(C)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H40O2Si2/c1-11-15-19(8,21-23(12-2,13-3)14-4)16-17-20-22(9,10)18(5,6)7/h1H,12-17H2,2-10H3/t19-/m1/s1 |
| InChIKey | BRIBJSJOCKXBJO-LJQANCHMSA-N |
| XLogP | 6.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|