C13H22N2O5 — CID 125490800
diethyl (E,2R,6S)-2-acetamido-6-aminohept-3-enedioate (PubChem CID 125490800) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is diethyl (E,2R,6S)-2-acetamido-6-aminohept-3-enedioate.
| Compound Name | diethyl (E,2R,6S)-2-acetamido-6-aminohept-3-enedioate |
|---|---|
| PubChem CID | 125490800 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | diethyl (E,2R,6S)-2-acetamido-6-aminohept-3-enedioate |
| SMILES | CCOC(=O)[C@@H](N)C/C=C/[C@@H](NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C13H22N2O5/c1-4-19-12(17)10(14)7-6-8-11(15-9(3)16)13(18)20-5-2/h6,8,10-11H,4-5,7,14H2,1-3H3,(H,15,16)/b8-6+/t10-,11+/m0/s1 |
| InChIKey | PHQNSHGWWAZZLV-YBFGJNSCSA-N |
| XLogP | -0.11 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|