C12H17NO2 — CID 125490825
(3S)-3-hydroxy-3,4-dimethyl-1-pyridin-2-ylpentan-2-one (PubChem CID 125490825) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (3S)-3-hydroxy-3,4-dimethyl-1-pyridin-2-ylpentan-2-one.
| Compound Name | (3S)-3-hydroxy-3,4-dimethyl-1-pyridin-2-ylpentan-2-one |
|---|---|
| PubChem CID | 125490825 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (3S)-3-hydroxy-3,4-dimethyl-1-pyridin-2-ylpentan-2-one |
| SMILES | CC(C)[C@](C)(O)C(=O)Cc1ccccn1 |
| InChI | InChI=1S/C12H17NO2/c1-9(2)12(3,15)11(14)8-10-6-4-5-7-13-10/h4-7,9,15H,8H2,1-3H3/t12-/m0/s1 |
| InChIKey | KMZKEZIYCLDWSU-LBPRGKRZSA-N |
| XLogP | 1.60 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |