C10H11BrN2O — CID 125492682
4-bromo-2-[(5R)-3-methyl-4,5-dihydro-1H-pyrazol-5-yl]phenol (PubChem CID 125492682) has the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. Its IUPAC name is 4-bromo-2-[(5R)-3-methyl-4,5-dihydro-1H-pyrazol-5-yl]phenol.
| Compound Name | 4-bromo-2-[(5R)-3-methyl-4,5-dihydro-1H-pyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 125492682 |
| Molecular Formula | C10H11BrN2O |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 4-bromo-2-[(5R)-3-methyl-4,5-dihydro-1H-pyrazol-5-yl]phenol |
| SMILES | CC1=NN[C@@H](c2cc(Br)ccc2O)C1 |
| InChI | InChI=1S/C10H11BrN2O/c1-6-4-9(13-12-6)8-5-7(11)2-3-10(8)14/h2-3,5,9,13-14H,4H2,1H3/t9-/m1/s1 |
| InChIKey | CTQOKZIASHJHKL-SECBINFHSA-N |
| XLogP | 2.57 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|