C13H11BrN2OS — CID 40729419
4-bromo-2-[(5S)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazol-5-yl]phenol (PubChem CID 40729419) has the molecular formula C13H11BrN2OS and a molecular weight of 323.22 g/mol. Its IUPAC name is 4-bromo-2-[(5S)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazol-5-yl]phenol.
| Compound Name | 4-bromo-2-[(5S)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 40729419 |
| Molecular Formula | C13H11BrN2OS |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 4-bromo-2-[(5S)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazol-5-yl]phenol |
| SMILES | Oc1ccc(Br)cc1[C@@H]1CC(c2cccs2)=NN1 |
| InChI | InChI=1S/C13H11BrN2OS/c14-8-3-4-12(17)9(6-8)10-7-11(16-15-10)13-2-1-5-18-13/h1-6,10,15,17H,7H2/t10-/m0/s1 |
| InChIKey | PBWOOWZSPXZERE-JTQLQIEISA-N |
| XLogP | 3.65 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|