C13H12ClFN2OS — CID 154829393
4-fluoro-2-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol;hydrochloride (PubChem CID 154829393) has the molecular formula C13H12ClFN2OS and a molecular weight of 298.77 g/mol. Its IUPAC name is 4-fluoro-2-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol;hydrochloride.
| Compound Name | 4-fluoro-2-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol;hydrochloride |
|---|---|
| PubChem CID | 154829393 |
| Molecular Formula | C13H12ClFN2OS |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 4-fluoro-2-(5-thiophen-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(F)cc1C1=NNC(c2cccs2)C1 |
| InChI | InChI=1S/C13H11FN2OS.ClH/c14-8-3-4-12(17)9(6-8)10-7-11(16-15-10)13-2-1-5-18-13;/h1-6,11,16-17H,7H2;1H |
| InChIKey | WKZJYFHOIYKZMD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|