C24H23BrN2O — CID 94486362
4-bromo-2-[(2S,6S)-2-(2-methylphenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 94486362) has the molecular formula C24H23BrN2O and a molecular weight of 435.37 g/mol. Its IUPAC name is 4-bromo-2-[(2S,6S)-2-(2-methylphenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 4-bromo-2-[(2S,6S)-2-(2-methylphenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 94486362 |
| Molecular Formula | C24H23BrN2O |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 4-bromo-2-[(2S,6S)-2-(2-methylphenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | Cc1ccc(C2=N[C@@H](c3ccccc3C)N[C@H](c3cc(Br)ccc3O)C2)cc1 |
| InChI | InChI=1S/C24H23BrN2O/c1-15-7-9-17(10-8-15)21-14-22(20-13-18(25)11-12-23(20)28)27-24(26-21)19-6-4-3-5-16(19)2/h3-13,22,24,27-28H,14H2,1-2H3/t22-,24+/m0/s1 |
| InChIKey | PKJRZZKFEPOWLG-LADGPHEKSA-N |
| XLogP | 5.99 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|