C23H21FN2O — CID 92698271
2-[(2R,6S)-2-(2-fluorophenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 92698271) has the molecular formula C23H21FN2O and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-[(2R,6S)-2-(2-fluorophenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 2-[(2R,6S)-2-(2-fluorophenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 92698271 |
| Molecular Formula | C23H21FN2O |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[(2R,6S)-2-(2-fluorophenyl)-4-(4-methylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | Cc1ccc(C2=N[C@H](c3ccccc3F)N[C@H](c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C23H21FN2O/c1-15-10-12-16(13-11-15)20-14-21(18-7-3-5-9-22(18)27)26-23(25-20)17-6-2-4-8-19(17)24/h2-13,21,23,26-27H,14H2,1H3/t21-,23-/m0/s1 |
| InChIKey | ZVUIECZXTCWZMJ-GMAHTHKFSA-N |
| XLogP | 5.06 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|