C22H21N3O — CID 94794218
2-[(2S,6R)-4-(4-methylphenyl)-2-pyridin-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 94794218) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-[(2S,6R)-4-(4-methylphenyl)-2-pyridin-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 2-[(2S,6R)-4-(4-methylphenyl)-2-pyridin-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 94794218 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-[(2S,6R)-4-(4-methylphenyl)-2-pyridin-3-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | Cc1ccc(C2=N[C@@H](c3cccnc3)N[C@@H](c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C22H21N3O/c1-15-8-10-16(11-9-15)19-13-20(18-6-2-3-7-21(18)26)25-22(24-19)17-5-4-12-23-14-17/h2-12,14,20,22,25-26H,13H2,1H3/t20-,22-/m1/s1 |
| InChIKey | HHJWZLSIVDDVSA-IFMALSPDSA-N |
| XLogP | 4.32 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|