C21H20N2OS — CID 94784247
2-[(2R,6R)-4-(4-methylphenyl)-2-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 94784247) has the molecular formula C21H20N2OS and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-[(2R,6R)-4-(4-methylphenyl)-2-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 2-[(2R,6R)-4-(4-methylphenyl)-2-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 94784247 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-[(2R,6R)-4-(4-methylphenyl)-2-thiophen-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | Cc1ccc(C2=N[C@H](c3cccs3)N[C@@H](c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C21H20N2OS/c1-14-8-10-15(11-9-14)17-13-18(16-5-2-3-6-19(16)24)23-21(22-17)20-7-4-12-25-20/h2-12,18,21,23-24H,13H2,1H3/t18-,21+/m1/s1 |
| InChIKey | BYGXIKGRRXZLGV-NQIIRXRSSA-N |
| XLogP | 4.98 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|