C10H17BrO — CID 125492862
4-[(1R,3S)-3-(bromomethyl)-2,2-dimethylcyclopropyl]butan-2-one (PubChem CID 125492862) has the molecular formula C10H17BrO and a molecular weight of 233.15 g/mol. Its IUPAC name is 4-[(1R,3S)-3-(bromomethyl)-2,2-dimethylcyclopropyl]butan-2-one.
| Compound Name | 4-[(1R,3S)-3-(bromomethyl)-2,2-dimethylcyclopropyl]butan-2-one |
|---|---|
| PubChem CID | 125492862 |
| Molecular Formula | C10H17BrO |
| Molecular Weight | 233.15 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 4-[(1R,3S)-3-(bromomethyl)-2,2-dimethylcyclopropyl]butan-2-one |
| SMILES | CC(=O)CC[C@@H]1[C@H](CBr)C1(C)C |
| InChI | InChI=1S/C10H17BrO/c1-7(12)4-5-8-9(6-11)10(8,2)3/h8-9H,4-6H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | AHHVZUZMRZMVFP-BDAKNGLRSA-N |
| XLogP | 3.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.15 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|